Diethyl suberate, (Diethyl octanedioate
Diethyl suberate
CAS: 2050-23-9
Molecular Formula: C12H22O4
Diethyl suberate, (Diethyl octanedioate - Names and Identifiers
| Name | Diethyl suberate |
| Synonyms | ETHYL SUBERATE DIETHYL SUBERATE Diethyl suberate Suberic acid d diethyl octanedioate DIETHYL OCTANEDIOATE 2050-23-9Diethyl suberate SUBERIC ACID DIETHYL ESTER OCTANEDIOIC ACID DIETHYL ESTER HEXANE-1,6-DICARBOXYLIC ACID DIETHYL ESTER Diethyl octanedioate~Suberic acid diethyl ester Octanedioic acid diethyl ester~Suberic acid diethyl ester Diethyl suberate, (Diethyl octanedioate |
| CAS | 2050-23-9 |
| EINECS | 218-084-4 |
| InChI | InChI=1/C12H22O4/c1-3-15-11(13)9-7-5-6-8-10-12(14)16-4-2/h3-10H2,1-2H3 |
Diethyl suberate, (Diethyl octanedioate - Physico-chemical Properties
| Molecular Formula | C12H22O4 |
| Molar Mass | 230.3 |
| Density | 0.982g/mLat 25°C(lit.) |
| Melting Point | 5 °C |
| Boling Point | 282°C(lit.) |
| Flash Point | >230°F |
| Solubility | Chloroform (Sparingly), Methanol (Slightly) |
| Vapor Presure | 0.00332mmHg at 25°C |
| Appearance | Colorless liquid |
| Color | Colourless |
| BRN | 1785500 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.432(lit.) |
| MDL | MFCD00009217 |
Diethyl suberate, (Diethyl octanedioate - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| HS Code | 29171900 |
Diethyl suberate, (Diethyl octanedioate - Introduction
Diethyl suberate, also known as phthalocyanine blue, is an organic compound. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Chemical formula: C16H22O4
2. Appearance: colorless liquid, with fruit flavor.
3. Solubility: diethylester can be dissolved in organic solvents, such as alcohols, ethers and esters.
4. Stability: Diethyl suberate is stable at room temperature, but may decompose at high temperature, sunlight or in contact with strong oxidants.
Use:
1. Pigment: Diethyl suberate is a blue organic pigment, commonly used in oil painting, plastic products, printing inks and pigment formulations.
2. Coating: Diethyl sulberate is also used as a thinner and plasticizer in coatings to improve the flexibility and adhesion of coatings.
3. Electronic products: diethylene is a common organic semiconductor material, which can be used to prepare electronic products such as organic light-emitting diodes (OLED).
Method:
Diethyl suberate is usually synthesized by esterification, the specific steps are as follows:
1. Suberic acid and ethanol are mixed in a certain molar ratio, and a catalyst is added.
2. Heat the mixture to the appropriate temperature and stir continuously.
3. After a period of time, Diethyl suberate is obtained.
Safety Information:
1. Diethyl suberate is generally considered safe under normal use, but it still needs to follow the general laboratory safety operation specifications.
2. Diethyl suberate has a certain degree of volatility and should avoid prolonged exposure to the air.
3. When using Diethyl suberate, you should pay attention to avoid contact with skin and eyes. If contact occurs, rinse immediately with plenty of water and seek medical help.
4. Diethyl sulberate is flammable at high temperatures and should avoid contact with open flames or high temperature surfaces.
Nature:
1. Chemical formula: C16H22O4
2. Appearance: colorless liquid, with fruit flavor.
3. Solubility: diethylester can be dissolved in organic solvents, such as alcohols, ethers and esters.
4. Stability: Diethyl suberate is stable at room temperature, but may decompose at high temperature, sunlight or in contact with strong oxidants.
Use:
1. Pigment: Diethyl suberate is a blue organic pigment, commonly used in oil painting, plastic products, printing inks and pigment formulations.
2. Coating: Diethyl sulberate is also used as a thinner and plasticizer in coatings to improve the flexibility and adhesion of coatings.
3. Electronic products: diethylene is a common organic semiconductor material, which can be used to prepare electronic products such as organic light-emitting diodes (OLED).
Method:
Diethyl suberate is usually synthesized by esterification, the specific steps are as follows:
1. Suberic acid and ethanol are mixed in a certain molar ratio, and a catalyst is added.
2. Heat the mixture to the appropriate temperature and stir continuously.
3. After a period of time, Diethyl suberate is obtained.
Safety Information:
1. Diethyl suberate is generally considered safe under normal use, but it still needs to follow the general laboratory safety operation specifications.
2. Diethyl suberate has a certain degree of volatility and should avoid prolonged exposure to the air.
3. When using Diethyl suberate, you should pay attention to avoid contact with skin and eyes. If contact occurs, rinse immediately with plenty of water and seek medical help.
4. Diethyl sulberate is flammable at high temperatures and should avoid contact with open flames or high temperature surfaces.
Last Update：2024-04-10 22:29:15
Supplier List
Multiple SpecificationsSpot supply
Product Name: Diethyl suberate Visit Supplier Webpage Request for quotationCAS: 2050-23-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Multiple SpecificationsSpot supply
Product Name: Diethyl suberate Visit Supplier Webpage Request for quotationCAS: 2050-23-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History
Diethyl suberate, (Diethyl octanedioate
3-[p-(9-Acridinylamino)phenyl]propenoic acid
1,4-Diacetoxy-2-butene
Ethyl acetate
3-[p-(9-Acridinylamino)phenyl]propenoic acid
1,4-Diacetoxy-2-butene
Ethyl acetate